C12H18N4O3 — CID 90447937
1,3-dimethyl-8-(2-propoxyethyl)-7H-purine-2,6-dione (PubChem CID 90447937) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 1,3-dimethyl-8-(2-propoxyethyl)-7H-purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-(2-propoxyethyl)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 90447937 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 1,3-dimethyl-8-(2-propoxyethyl)-7H-purine-2,6-dione |
| SMILES | CCCOCCc1nc2c([nH]1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C12H18N4O3/c1-4-6-19-7-5-8-13-9-10(14-8)15(2)12(18)16(3)11(9)17/h4-7H2,1-3H3,(H,13,14) |
| InChIKey | DPGYSEHZWIFFMF-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|