C13H21N5O4S — CID 91948077
N-[2-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)ethyl]butane-1-sulfonamide (PubChem CID 91948077) has the molecular formula C13H21N5O4S and a molecular weight of 343.41 g/mol. Its IUPAC name is N-[2-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)ethyl]butane-1-sulfonamide.
| Compound Name | N-[2-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)ethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 91948077 |
| Molecular Formula | C13H21N5O4S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-[2-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)ethyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCCc1nc2c([nH]1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C13H21N5O4S/c1-4-5-8-23(21,22)14-7-6-9-15-10-11(16-9)17(2)13(20)18(3)12(10)19/h14H,4-8H2,1-3H3,(H,15,16) |
| InChIKey | UAUYZSWCTMOYHN-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |