C14H20N4O4 — CID 82464701
5-(1-methyl-2,6-dioxo-3-propyl-7H-purin-8-yl)pentanoic acid (PubChem CID 82464701) has the molecular formula C14H20N4O4 and a molecular weight of 308.34 g/mol. Its IUPAC name is 5-(1-methyl-2,6-dioxo-3-propyl-7H-purin-8-yl)pentanoic acid.
| Compound Name | 5-(1-methyl-2,6-dioxo-3-propyl-7H-purin-8-yl)pentanoic acid |
|---|---|
| PubChem CID | 82464701 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 5-(1-methyl-2,6-dioxo-3-propyl-7H-purin-8-yl)pentanoic acid |
| SMILES | CCCn1c(=O)n(C)c(=O)c2[nH]c(CCCCC(=O)O)nc21 |
| InChI | InChI=1S/C14H20N4O4/c1-3-8-18-12-11(13(21)17(2)14(18)22)15-9(16-12)6-4-5-7-10(19)20/h3-8H2,1-2H3,(H,15,16)(H,19,20) |
| InChIKey | ZHXMYYBUTXEGMI-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|