C20H29N5O5 — CID 10477169
(E)-4-[5-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)pentylamino]-4-oxobut-2-enoic acid (PubChem CID 10477169) has the molecular formula C20H29N5O5 and a molecular weight of 419.48 g/mol. Its IUPAC name is (E)-4-[5-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)pentylamino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[5-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)pentylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 10477169 |
| Molecular Formula | C20H29N5O5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | (E)-4-[5-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)pentylamino]-4-oxobut-2-enoic acid |
| SMILES | CCCn1c(=O)c2[nH]c(CCCCCNC(=O)/C=C/C(=O)O)nc2n(CCC)c1=O |
| InChI | InChI=1S/C20H29N5O5/c1-3-12-24-18-17(19(29)25(13-4-2)20(24)30)22-14(23-18)8-6-5-7-11-21-15(26)9-10-16(27)28/h9-10H,3-8,11-13H2,1-2H3,(H,21,26)(H,22,23)(H,27,28)/b10-9+ |
| InChIKey | QJJFZHGVYFSBEF-MDZDMXLPSA-N |
| XLogP | 1.18 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|