C17H26N4O3 — CID 157241521
1,3-dibutyl-8-(3-oxobutyl)-7H-purine-2,6-dione (PubChem CID 157241521) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 1,3-dibutyl-8-(3-oxobutyl)-7H-purine-2,6-dione.
| Compound Name | 1,3-dibutyl-8-(3-oxobutyl)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 157241521 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 1,3-dibutyl-8-(3-oxobutyl)-7H-purine-2,6-dione |
| SMILES | CCCCn1c(=O)c2[nH]c(CCC(C)=O)nc2n(CCCC)c1=O |
| InChI | InChI=1S/C17H26N4O3/c1-4-6-10-20-15-14(18-13(19-15)9-8-12(3)22)16(23)21(17(20)24)11-7-5-2/h4-11H2,1-3H3,(H,18,19) |
| InChIKey | AVGSFNMHPGQZEQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |