C14H16N4O8 — CID 175147253
3-[1,3-bis(2-carboxyethyl)-2,6-dioxo-7H-purin-8-yl]propanoic acid (PubChem CID 175147253) has the molecular formula C14H16N4O8 and a molecular weight of 368.30 g/mol. Its IUPAC name is 3-[1,3-bis(2-carboxyethyl)-2,6-dioxo-7H-purin-8-yl]propanoic acid.
| Compound Name | 3-[1,3-bis(2-carboxyethyl)-2,6-dioxo-7H-purin-8-yl]propanoic acid |
|---|---|
| PubChem CID | 175147253 |
| Molecular Formula | C14H16N4O8 |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 3-[1,3-bis(2-carboxyethyl)-2,6-dioxo-7H-purin-8-yl]propanoic acid |
| SMILES | O=C(O)CCc1nc2c([nH]1)c(=O)n(CCC(=O)O)c(=O)n2CCC(=O)O |
| InChI | InChI=1S/C14H16N4O8/c19-8(20)2-1-7-15-11-12(16-7)17(5-3-9(21)22)14(26)18(13(11)25)6-4-10(23)24/h1-6H2,(H,15,16)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | CYHHMXRDJFVDSE-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 184.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |