C16H18N4O3 — CID 11438408
3-benzyl-8-(hydroxymethyl)-1-propyl-7H-purine-2,6-dione (PubChem CID 11438408) has the molecular formula C16H18N4O3 and a molecular weight of 314.34 g/mol. Its IUPAC name is 3-benzyl-8-(hydroxymethyl)-1-propyl-7H-purine-2,6-dione.
| Compound Name | 3-benzyl-8-(hydroxymethyl)-1-propyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 11438408 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 3-benzyl-8-(hydroxymethyl)-1-propyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(CO)nc2n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C16H18N4O3/c1-2-8-19-15(22)13-14(18-12(10-21)17-13)20(16(19)23)9-11-6-4-3-5-7-11/h3-7,21H,2,8-10H2,1H3,(H,17,18) |
| InChIKey | TZQMVQWWZKZRJT-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |