C19H20N6O3 — CID 18449552
8-benzyl-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1-propyl-7H-purine-2,6-dione (PubChem CID 18449552) has the molecular formula C19H20N6O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is 8-benzyl-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1-propyl-7H-purine-2,6-dione.
| Compound Name | 8-benzyl-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1-propyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 18449552 |
| Molecular Formula | C19H20N6O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 8-benzyl-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1-propyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(Cc3ccccc3)nc2n(CCc2ncno2)c1=O |
| InChI | InChI=1S/C19H20N6O3/c1-2-9-25-18(26)16-17(23-14(22-16)11-13-6-4-3-5-7-13)24(19(25)27)10-8-15-20-12-21-28-15/h3-7,12H,2,8-11H2,1H3,(H,22,23) |
| InChIKey | NYCHLIWQJAORPW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |