C21H21N5O4S — CID 18449502
3-[2-(4-nitrophenyl)ethyl]-1-propyl-8-(thiophen-2-ylmethyl)-7H-purine-2,6-dione (PubChem CID 18449502) has the molecular formula C21H21N5O4S and a molecular weight of 439.50 g/mol. Its IUPAC name is 3-[2-(4-nitrophenyl)ethyl]-1-propyl-8-(thiophen-2-ylmethyl)-7H-purine-2,6-dione.
| Compound Name | 3-[2-(4-nitrophenyl)ethyl]-1-propyl-8-(thiophen-2-ylmethyl)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 18449502 |
| Molecular Formula | C21H21N5O4S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 3-[2-(4-nitrophenyl)ethyl]-1-propyl-8-(thiophen-2-ylmethyl)-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(Cc3cccs3)nc2n(CCc2ccc([N+](=O)[O-])cc2)c1=O |
| InChI | InChI=1S/C21H21N5O4S/c1-2-10-25-20(27)18-19(23-17(22-18)13-16-4-3-12-31-16)24(21(25)28)11-9-14-5-7-15(8-6-14)26(29)30/h3-8,12H,2,9-11,13H2,1H3,(H,22,23) |
| InChIKey | JXHJQCQMGILVQI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|