C12H12N4O2S — CID 112568925
3-ethyl-8-(thiophen-2-ylmethyl)-7H-purine-2,6-dione (PubChem CID 112568925) has the molecular formula C12H12N4O2S and a molecular weight of 276.32 g/mol. Its IUPAC name is 3-ethyl-8-(thiophen-2-ylmethyl)-7H-purine-2,6-dione.
| Compound Name | 3-ethyl-8-(thiophen-2-ylmethyl)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 112568925 |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 3-ethyl-8-(thiophen-2-ylmethyl)-7H-purine-2,6-dione |
| SMILES | CCn1c(=O)[nH]c(=O)c2[nH]c(Cc3cccs3)nc21 |
| InChI | InChI=1S/C12H12N4O2S/c1-2-16-10-9(11(17)15-12(16)18)13-8(14-10)6-7-4-3-5-19-7/h3-5H,2,6H2,1H3,(H,13,14)(H,15,17,18) |
| InChIKey | XXQVTJVRRFIKSX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |