C14H14N4O3 — CID 115925596
3-ethyl-8-[hydroxy(phenyl)methyl]-7H-purine-2,6-dione (PubChem CID 115925596) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 3-ethyl-8-[hydroxy(phenyl)methyl]-7H-purine-2,6-dione.
| Compound Name | 3-ethyl-8-[hydroxy(phenyl)methyl]-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 115925596 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 3-ethyl-8-[hydroxy(phenyl)methyl]-7H-purine-2,6-dione |
| SMILES | CCn1c(=O)[nH]c(=O)c2[nH]c(C(O)c3ccccc3)nc21 |
| InChI | InChI=1S/C14H14N4O3/c1-2-18-12-9(13(20)17-14(18)21)15-11(16-12)10(19)8-6-4-3-5-7-8/h3-7,10,19H,2H2,1H3,(H,15,16)(H,17,20,21) |
| InChIKey | VUEVIFIAPIMUCK-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |