C11H9ClN4O3 — CID 106688329
8-(5-chlorofuran-2-yl)-3-ethyl-7H-purine-2,6-dione (PubChem CID 106688329) has the molecular formula C11H9ClN4O3 and a molecular weight of 280.67 g/mol. Its IUPAC name is 8-(5-chlorofuran-2-yl)-3-ethyl-7H-purine-2,6-dione.
| Compound Name | 8-(5-chlorofuran-2-yl)-3-ethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 106688329 |
| Molecular Formula | C11H9ClN4O3 |
| Molecular Weight | 280.67 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 8-(5-chlorofuran-2-yl)-3-ethyl-7H-purine-2,6-dione |
| SMILES | CCn1c(=O)[nH]c(=O)c2[nH]c(-c3ccc(Cl)o3)nc21 |
| InChI | InChI=1S/C11H9ClN4O3/c1-2-16-9-7(10(17)15-11(16)18)13-8(14-9)5-3-4-6(12)19-5/h3-4H,2H2,1H3,(H,13,14)(H,15,17,18) |
| InChIKey | OFQWYEOZEDJWRW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.67 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |