C13H11BrN4O2 — CID 115600497
8-(3-bromophenyl)-3-ethyl-7H-purine-2,6-dione (PubChem CID 115600497) has the molecular formula C13H11BrN4O2 and a molecular weight of 335.16 g/mol. Its IUPAC name is 8-(3-bromophenyl)-3-ethyl-7H-purine-2,6-dione.
| Compound Name | 8-(3-bromophenyl)-3-ethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 115600497 |
| Molecular Formula | C13H11BrN4O2 |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 8-(3-bromophenyl)-3-ethyl-7H-purine-2,6-dione |
| SMILES | CCn1c(=O)[nH]c(=O)c2[nH]c(-c3cccc(Br)c3)nc21 |
| InChI | InChI=1S/C13H11BrN4O2/c1-2-18-11-9(12(19)17-13(18)20)15-10(16-11)7-4-3-5-8(14)6-7/h3-6H,2H2,1H3,(H,15,16)(H,17,19,20) |
| InChIKey | FIWOPLLORHZNFZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |