C10H9N5O3 — CID 136926833
3-ethyl-8-(1,2-oxazol-3-yl)-7H-purine-2,6-dione (PubChem CID 136926833) has the molecular formula C10H9N5O3 and a molecular weight of 247.21 g/mol. Its IUPAC name is 3-ethyl-8-(1,2-oxazol-3-yl)-7H-purine-2,6-dione.
| Compound Name | 3-ethyl-8-(1,2-oxazol-3-yl)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 136926833 |
| Molecular Formula | C10H9N5O3 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 3-ethyl-8-(1,2-oxazol-3-yl)-7H-purine-2,6-dione |
| SMILES | CCn1c(=O)[nH]c(=O)c2[nH]c(-c3ccon3)nc21 |
| InChI | InChI=1S/C10H9N5O3/c1-2-15-8-6(9(16)13-10(15)17)11-7(12-8)5-3-4-18-14-5/h3-4H,2H2,1H3,(H,11,12)(H,13,16,17) |
| InChIKey | LRPBAUCBECXWII-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |