C12H14N6O2 — CID 136785876
8-(1-methylpyrazol-3-yl)-3-propyl-7H-purine-2,6-dione (PubChem CID 136785876) has the molecular formula C12H14N6O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 8-(1-methylpyrazol-3-yl)-3-propyl-7H-purine-2,6-dione.
| Compound Name | 8-(1-methylpyrazol-3-yl)-3-propyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 136785876 |
| Molecular Formula | C12H14N6O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 8-(1-methylpyrazol-3-yl)-3-propyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)[nH]c(=O)c2[nH]c(-c3ccn(C)n3)nc21 |
| InChI | InChI=1S/C12H14N6O2/c1-3-5-18-10-8(11(19)15-12(18)20)13-9(14-10)7-4-6-17(2)16-7/h4,6H,3,5H2,1-2H3,(H,13,14)(H,15,19,20) |
| InChIKey | YCRVCMFBDHQJLW-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |