C14H16N4O2S — CID 115925490
8-(3-ethylthiophen-2-yl)-3-propyl-7H-purine-2,6-dione (PubChem CID 115925490) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 8-(3-ethylthiophen-2-yl)-3-propyl-7H-purine-2,6-dione.
| Compound Name | 8-(3-ethylthiophen-2-yl)-3-propyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 115925490 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 8-(3-ethylthiophen-2-yl)-3-propyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)[nH]c(=O)c2[nH]c(-c3sccc3CC)nc21 |
| InChI | InChI=1S/C14H16N4O2S/c1-3-6-18-12-9(13(19)17-14(18)20)15-11(16-12)10-8(4-2)5-7-21-10/h5,7H,3-4,6H2,1-2H3,(H,15,16)(H,17,19,20) |
| InChIKey | MXKCUJABYQTZHH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |