C12H13N5O2S — CID 115925487
8-(2-methyl-1,3-thiazol-4-yl)-3-propyl-7H-purine-2,6-dione (PubChem CID 115925487) has the molecular formula C12H13N5O2S and a molecular weight of 291.34 g/mol. Its IUPAC name is 8-(2-methyl-1,3-thiazol-4-yl)-3-propyl-7H-purine-2,6-dione.
| Compound Name | 8-(2-methyl-1,3-thiazol-4-yl)-3-propyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 115925487 |
| Molecular Formula | C12H13N5O2S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 8-(2-methyl-1,3-thiazol-4-yl)-3-propyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)[nH]c(=O)c2[nH]c(-c3csc(C)n3)nc21 |
| InChI | InChI=1S/C12H13N5O2S/c1-3-4-17-10-8(11(18)16-12(17)19)14-9(15-10)7-5-20-6(2)13-7/h5H,3-4H2,1-2H3,(H,14,15)(H,16,18,19) |
| InChIKey | LRTGBALDBHPAMH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |