C10H15N5O3 — CID 82465307
8-(2-hydroxyethylamino)-3-propyl-7H-purine-2,6-dione (PubChem CID 82465307) has the molecular formula C10H15N5O3 and a molecular weight of 253.26 g/mol. Its IUPAC name is 8-(2-hydroxyethylamino)-3-propyl-7H-purine-2,6-dione.
| Compound Name | 8-(2-hydroxyethylamino)-3-propyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 82465307 |
| Molecular Formula | C10H15N5O3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 8-(2-hydroxyethylamino)-3-propyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)[nH]c(=O)c2[nH]c(NCCO)nc21 |
| InChI | InChI=1S/C10H15N5O3/c1-2-4-15-7-6(8(17)14-10(15)18)12-9(13-7)11-3-5-16/h16H,2-5H2,1H3,(H2,11,12,13)(H,14,17,18) |
| InChIKey | DKUJAATZSAFPGZ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 115.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |