C7H10N6O2 — CID 82465284
3-ethyl-8-hydrazinyl-7H-purine-2,6-dione (PubChem CID 82465284) has the molecular formula C7H10N6O2 and a molecular weight of 210.20 g/mol. Its IUPAC name is 3-ethyl-8-hydrazinyl-7H-purine-2,6-dione.
| Compound Name | 3-ethyl-8-hydrazinyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 82465284 |
| Molecular Formula | C7H10N6O2 |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 3-ethyl-8-hydrazinyl-7H-purine-2,6-dione |
| SMILES | CCn1c(=O)[nH]c(=O)c2[nH]c(NN)nc21 |
| InChI | InChI=1S/C7H10N6O2/c1-2-13-4-3(5(14)11-7(13)15)9-6(10-4)12-8/h2,8H2,1H3,(H2,9,10,12)(H,11,14,15) |
| InChIKey | DBFVKFGQMYUWEX-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 121.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|