C12H19N5O3 — CID 82465364
8-(3-hydroxypropylamino)-3-(2-methylpropyl)-7H-purine-2,6-dione (PubChem CID 82465364) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is 8-(3-hydroxypropylamino)-3-(2-methylpropyl)-7H-purine-2,6-dione.
| Compound Name | 8-(3-hydroxypropylamino)-3-(2-methylpropyl)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 82465364 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 8-(3-hydroxypropylamino)-3-(2-methylpropyl)-7H-purine-2,6-dione |
| SMILES | CC(C)Cn1c(=O)[nH]c(=O)c2[nH]c(NCCCO)nc21 |
| InChI | InChI=1S/C12H19N5O3/c1-7(2)6-17-9-8(10(19)16-12(17)20)14-11(15-9)13-4-3-5-18/h7,18H,3-6H2,1-2H3,(H2,13,14,15)(H,16,19,20) |
| InChIKey | PYDGMHVJAQTANE-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 115.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|