C12H17ClN4O2 — CID 102549471
8-(1-chloroethyl)-7-methyl-3-(2-methylpropyl)purine-2,6-dione (PubChem CID 102549471) has the molecular formula C12H17ClN4O2 and a molecular weight of 284.75 g/mol. Its IUPAC name is 8-(1-chloroethyl)-7-methyl-3-(2-methylpropyl)purine-2,6-dione.
| Compound Name | 8-(1-chloroethyl)-7-methyl-3-(2-methylpropyl)purine-2,6-dione |
|---|---|
| PubChem CID | 102549471 |
| Molecular Formula | C12H17ClN4O2 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 8-(1-chloroethyl)-7-methyl-3-(2-methylpropyl)purine-2,6-dione |
| SMILES | CC(C)Cn1c(=O)[nH]c(=O)c2c1nc(C(C)Cl)n2C |
| InChI | InChI=1S/C12H17ClN4O2/c1-6(2)5-17-10-8(11(18)15-12(17)19)16(4)9(14-10)7(3)13/h6-7H,5H2,1-4H3,(H,15,18,19) |
| InChIKey | RTZZHRNDGBXXFF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|