C9H13N5O2 — CID 82463947
8-(1-aminoethyl)-3,7-dimethylpurine-2,6-dione (PubChem CID 82463947) has the molecular formula C9H13N5O2 and a molecular weight of 223.24 g/mol. Its IUPAC name is 8-(1-aminoethyl)-3,7-dimethylpurine-2,6-dione.
| Compound Name | 8-(1-aminoethyl)-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 82463947 |
| Molecular Formula | C9H13N5O2 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 8-(1-aminoethyl)-3,7-dimethylpurine-2,6-dione |
| SMILES | CC(N)c1nc2c(c(=O)[nH]c(=O)n2C)n1C |
| InChI | InChI=1S/C9H13N5O2/c1-4(10)6-11-7-5(13(6)2)8(15)12-9(16)14(7)3/h4H,10H2,1-3H3,(H,12,15,16) |
| InChIKey | VUIUUDLUKSYCQB-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |