C14H22N4O3 — CID 67735598
8-(6-hydroxyheptyl)-3,7-dimethylpurine-2,6-dione (PubChem CID 67735598) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is 8-(6-hydroxyheptyl)-3,7-dimethylpurine-2,6-dione.
| Compound Name | 8-(6-hydroxyheptyl)-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 67735598 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 8-(6-hydroxyheptyl)-3,7-dimethylpurine-2,6-dione |
| SMILES | CC(O)CCCCCc1nc2c(c(=O)[nH]c(=O)n2C)n1C |
| InChI | InChI=1S/C14H22N4O3/c1-9(19)7-5-4-6-8-10-15-12-11(17(10)2)13(20)16-14(21)18(12)3/h9,19H,4-8H2,1-3H3,(H,16,20,21) |
| InChIKey | FSNJAGVHLRYCFH-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|