C20H27N5O3 — CID 67779715
8-[6-(benzylamino)-5-hydroxyhexyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 67779715) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is 8-[6-(benzylamino)-5-hydroxyhexyl]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 8-[6-(benzylamino)-5-hydroxyhexyl]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 67779715 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 8-[6-(benzylamino)-5-hydroxyhexyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1c(CCCCC(O)CNCc2ccccc2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C20H27N5O3/c1-24-16(22-18-17(24)19(27)23-20(28)25(18)2)11-7-6-10-15(26)13-21-12-14-8-4-3-5-9-14/h3-5,8-9,15,21,26H,6-7,10-13H2,1-2H3,(H,23,27,28) |
| InChIKey | AICNTCNJOZZWNB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|