C17H18N6O2 — CID 43840193
3-[8-[(benzylamino)methyl]-3-methyl-2,6-dioxopurin-7-yl]propanenitrile (PubChem CID 43840193) has the molecular formula C17H18N6O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is 3-[8-[(benzylamino)methyl]-3-methyl-2,6-dioxopurin-7-yl]propanenitrile.
| Compound Name | 3-[8-[(benzylamino)methyl]-3-methyl-2,6-dioxopurin-7-yl]propanenitrile |
|---|---|
| PubChem CID | 43840193 |
| Molecular Formula | C17H18N6O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 3-[8-[(benzylamino)methyl]-3-methyl-2,6-dioxopurin-7-yl]propanenitrile |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(CNCc1ccccc1)n2CCC#N |
| InChI | InChI=1S/C17H18N6O2/c1-22-15-14(16(24)21-17(22)25)23(9-5-8-18)13(20-15)11-19-10-12-6-3-2-4-7-12/h2-4,6-7,19H,5,9-11H2,1H3,(H,21,24,25) |
| InChIKey | DQZJHBGORFCGGP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 108.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |