C22H21N5O3 — CID 43840181
3-methyl-8-[(4-methylanilino)methyl]-7-phenacylpurine-2,6-dione (PubChem CID 43840181) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 3-methyl-8-[(4-methylanilino)methyl]-7-phenacylpurine-2,6-dione.
| Compound Name | 3-methyl-8-[(4-methylanilino)methyl]-7-phenacylpurine-2,6-dione |
|---|---|
| PubChem CID | 43840181 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 3-methyl-8-[(4-methylanilino)methyl]-7-phenacylpurine-2,6-dione |
| SMILES | Cc1ccc(NCc2nc3c(c(=O)[nH]c(=O)n3C)n2CC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21N5O3/c1-14-8-10-16(11-9-14)23-12-18-24-20-19(21(29)25-22(30)26(20)2)27(18)13-17(28)15-6-4-3-5-7-15/h3-11,23H,12-13H2,1-2H3,(H,25,29,30) |
| InChIKey | ISBBEGNNGRLIDT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |