C16H17N5O4 — CID 16618694
methyl 2-[3-methyl-8-(4-methylanilino)-2,6-dioxopurin-7-yl]acetate (PubChem CID 16618694) has the molecular formula C16H17N5O4 and a molecular weight of 343.34 g/mol. Its IUPAC name is methyl 2-[3-methyl-8-(4-methylanilino)-2,6-dioxopurin-7-yl]acetate.
| Compound Name | methyl 2-[3-methyl-8-(4-methylanilino)-2,6-dioxopurin-7-yl]acetate |
|---|---|
| PubChem CID | 16618694 |
| Molecular Formula | C16H17N5O4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | methyl 2-[3-methyl-8-(4-methylanilino)-2,6-dioxopurin-7-yl]acetate |
| SMILES | COC(=O)Cn1c(Nc2ccc(C)cc2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C16H17N5O4/c1-9-4-6-10(7-5-9)17-15-18-13-12(21(15)8-11(22)25-3)14(23)19-16(24)20(13)2/h4-7H,8H2,1-3H3,(H,17,18)(H,19,23,24) |
| InChIKey | WYHYRGRHTYNBND-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |