C15H17N5O4 — CID 99806691
8-anilino-7-[(2R)-2,3-dihydroxypropyl]-3-methylpurine-2,6-dione (PubChem CID 99806691) has the molecular formula C15H17N5O4 and a molecular weight of 331.33 g/mol. Its IUPAC name is 8-anilino-7-[(2R)-2,3-dihydroxypropyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-anilino-7-[(2R)-2,3-dihydroxypropyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 99806691 |
| Molecular Formula | C15H17N5O4 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 8-anilino-7-[(2R)-2,3-dihydroxypropyl]-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(Nc1ccccc1)n2C[C@@H](O)CO |
| InChI | InChI=1S/C15H17N5O4/c1-19-12-11(13(23)18-15(19)24)20(7-10(22)8-21)14(17-12)16-9-5-3-2-4-6-9/h2-6,10,21-22H,7-8H2,1H3,(H,16,17)(H,18,23,24)/t10-/m1/s1 |
| InChIKey | ZTSFQFKOFSBVDQ-SNVBAGLBSA-N |
| XLogP | -0.48 |
| TPSA | 125.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |