C13H14ClN5O2 — CID 166190002
8-anilino-3,7-dimethylpurine-2,6-dione;hydrochloride (PubChem CID 166190002) has the molecular formula C13H14ClN5O2 and a molecular weight of 307.74 g/mol. Its IUPAC name is 8-anilino-3,7-dimethylpurine-2,6-dione;hydrochloride.
| Compound Name | 8-anilino-3,7-dimethylpurine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 166190002 |
| Molecular Formula | C13H14ClN5O2 |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 8-anilino-3,7-dimethylpurine-2,6-dione;hydrochloride |
| SMILES | Cl.Cn1c(Nc2ccccc2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C13H13N5O2.ClH/c1-17-9-10(18(2)13(20)16-11(9)19)15-12(17)14-8-6-4-3-5-7-8;/h3-7H,1-2H3,(H,14,15)(H,16,19,20);1H |
| InChIKey | HBGVFGKOZMCMQA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |