C17H20N6O2 — CID 97075217
3,7-dimethyl-8-[[(3R)-1-phenylpyrrolidin-3-yl]amino]purine-2,6-dione (PubChem CID 97075217) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is 3,7-dimethyl-8-[[(3R)-1-phenylpyrrolidin-3-yl]amino]purine-2,6-dione.
| Compound Name | 3,7-dimethyl-8-[[(3R)-1-phenylpyrrolidin-3-yl]amino]purine-2,6-dione |
|---|---|
| PubChem CID | 97075217 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 3,7-dimethyl-8-[[(3R)-1-phenylpyrrolidin-3-yl]amino]purine-2,6-dione |
| SMILES | Cn1c(N[C@@H]2CCN(c3ccccc3)C2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C17H20N6O2/c1-21-13-14(22(2)17(25)20-15(13)24)19-16(21)18-11-8-9-23(10-11)12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3,(H,18,19)(H,20,24,25)/t11-/m1/s1 |
| InChIKey | OYAJNCVBCLWBFL-LLVKDONJSA-N |
| XLogP | 0.65 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |