C17H16N4O3 — CID 44721698
9-benzyl-1-methyl-7,9-dihydro-6H-purino[7,8-a]pyridine-2,4,8-trione (PubChem CID 44721698) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 9-benzyl-1-methyl-7,9-dihydro-6H-purino[7,8-a]pyridine-2,4,8-trione.
| Compound Name | 9-benzyl-1-methyl-7,9-dihydro-6H-purino[7,8-a]pyridine-2,4,8-trione |
|---|---|
| PubChem CID | 44721698 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 9-benzyl-1-methyl-7,9-dihydro-6H-purino[7,8-a]pyridine-2,4,8-trione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc1n2CCC(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C17H16N4O3/c1-20-15-13(16(23)19-17(20)24)21-8-7-12(22)11(14(21)18-15)9-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3,(H,19,23,24) |
| InChIKey | PVDSRSWMNMZCDM-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |