C14H15N5O2 — CID 677712
8-(benzylamino)-3,7-dimethylpurine-2,6-dione (PubChem CID 677712) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 8-(benzylamino)-3,7-dimethylpurine-2,6-dione.
| Compound Name | 8-(benzylamino)-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 677712 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 8-(benzylamino)-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1c(NCc2ccccc2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C14H15N5O2/c1-18-10-11(19(2)14(21)17-12(10)20)16-13(18)15-8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H,15,16)(H,17,20,21) |
| InChIKey | SGUHCAOVLSRBEM-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |