C19H25N5O3 — CID 645373
8-(3-methoxypropylamino)-3-methyl-7-(3-phenylpropyl)purine-2,6-dione (PubChem CID 645373) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 8-(3-methoxypropylamino)-3-methyl-7-(3-phenylpropyl)purine-2,6-dione.
| Compound Name | 8-(3-methoxypropylamino)-3-methyl-7-(3-phenylpropyl)purine-2,6-dione |
|---|---|
| PubChem CID | 645373 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 8-(3-methoxypropylamino)-3-methyl-7-(3-phenylpropyl)purine-2,6-dione |
| SMILES | COCCCNc1nc2c(c(=O)[nH]c(=O)n2C)n1CCCc1ccccc1 |
| InChI | InChI=1S/C19H25N5O3/c1-23-16-15(17(25)22-19(23)26)24(18(21-16)20-11-7-13-27-2)12-6-10-14-8-4-3-5-9-14/h3-5,8-9H,6-7,10-13H2,1-2H3,(H,20,21)(H,22,25,26) |
| InChIKey | UMRGHGAXWBFUTG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|