C10H15N5O3 — CID 652075
7-(2-methoxyethyl)-3-methyl-8-(methylamino)purine-2,6-dione (PubChem CID 652075) has the molecular formula C10H15N5O3 and a molecular weight of 253.26 g/mol. Its IUPAC name is 7-(2-methoxyethyl)-3-methyl-8-(methylamino)purine-2,6-dione.
| Compound Name | 7-(2-methoxyethyl)-3-methyl-8-(methylamino)purine-2,6-dione |
|---|---|
| PubChem CID | 652075 |
| Molecular Formula | C10H15N5O3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 7-(2-methoxyethyl)-3-methyl-8-(methylamino)purine-2,6-dione |
| SMILES | CNc1nc2c(c(=O)[nH]c(=O)n2C)n1CCOC |
| InChI | InChI=1S/C10H15N5O3/c1-11-9-12-7-6(15(9)4-5-18-3)8(16)13-10(17)14(7)2/h4-5H2,1-3H3,(H,11,12)(H,13,16,17) |
| InChIKey | NINGSMBCCRCAJD-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |