C10H14N6O3 — CID 27370815
N-methyl-2-[3-methyl-8-(methylamino)-2,6-dioxopurin-7-yl]acetamide (PubChem CID 27370815) has the molecular formula C10H14N6O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is N-methyl-2-[3-methyl-8-(methylamino)-2,6-dioxopurin-7-yl]acetamide.
| Compound Name | N-methyl-2-[3-methyl-8-(methylamino)-2,6-dioxopurin-7-yl]acetamide |
|---|---|
| PubChem CID | 27370815 |
| Molecular Formula | C10H14N6O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | N-methyl-2-[3-methyl-8-(methylamino)-2,6-dioxopurin-7-yl]acetamide |
| SMILES | CNC(=O)Cn1c(NC)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C10H14N6O3/c1-11-5(17)4-16-6-7(13-9(16)12-2)15(3)10(19)14-8(6)18/h4H2,1-3H3,(H,11,17)(H,12,13)(H,14,18,19) |
| InChIKey | CQKRGWJGTCZFDI-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |