C9H11N5O4 — CID 5136088
2-[(3,7-dimethyl-2,6-dioxopurin-8-yl)amino]acetic acid (PubChem CID 5136088) has the molecular formula C9H11N5O4 and a molecular weight of 253.22 g/mol. Its IUPAC name is 2-[(3,7-dimethyl-2,6-dioxopurin-8-yl)amino]acetic acid.
| Compound Name | 2-[(3,7-dimethyl-2,6-dioxopurin-8-yl)amino]acetic acid |
|---|---|
| PubChem CID | 5136088 |
| Molecular Formula | C9H11N5O4 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 2-[(3,7-dimethyl-2,6-dioxopurin-8-yl)amino]acetic acid |
| SMILES | Cn1c(NCC(=O)O)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C9H11N5O4/c1-13-5-6(11-8(13)10-3-4(15)16)14(2)9(18)12-7(5)17/h3H2,1-2H3,(H,10,11)(H,15,16)(H,12,17,18) |
| InChIKey | YMMCIZSRBDSKSJ-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |