C15H15N5O4 — CID 25283433
2-[3-methyl-8-(2-methylanilino)-2,6-dioxopurin-7-yl]acetic acid (PubChem CID 25283433) has the molecular formula C15H15N5O4 and a molecular weight of 329.32 g/mol. Its IUPAC name is 2-[3-methyl-8-(2-methylanilino)-2,6-dioxopurin-7-yl]acetic acid.
| Compound Name | 2-[3-methyl-8-(2-methylanilino)-2,6-dioxopurin-7-yl]acetic acid |
|---|---|
| PubChem CID | 25283433 |
| Molecular Formula | C15H15N5O4 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-[3-methyl-8-(2-methylanilino)-2,6-dioxopurin-7-yl]acetic acid |
| SMILES | Cc1ccccc1Nc1nc2c(c(=O)[nH]c(=O)n2C)n1CC(=O)O |
| InChI | InChI=1S/C15H15N5O4/c1-8-5-3-4-6-9(8)16-14-17-12-11(20(14)7-10(21)22)13(23)18-15(24)19(12)2/h3-6H,7H2,1-2H3,(H,16,17)(H,21,22)(H,18,23,24) |
| InChIKey | FBMFXHDJUHOUMC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |