C15H25N5O3 — CID 7025678
8-(3-methoxypropylamino)-3-methyl-7-pentylpurine-2,6-dione (PubChem CID 7025678) has the molecular formula C15H25N5O3 and a molecular weight of 323.40 g/mol. Its IUPAC name is 8-(3-methoxypropylamino)-3-methyl-7-pentylpurine-2,6-dione.
| Compound Name | 8-(3-methoxypropylamino)-3-methyl-7-pentylpurine-2,6-dione |
|---|---|
| PubChem CID | 7025678 |
| Molecular Formula | C15H25N5O3 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 8-(3-methoxypropylamino)-3-methyl-7-pentylpurine-2,6-dione |
| SMILES | CCCCCn1c(NCCCOC)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C15H25N5O3/c1-4-5-6-9-20-11-12(19(2)15(22)18-13(11)21)17-14(20)16-8-7-10-23-3/h4-10H2,1-3H3,(H,16,17)(H,18,21,22) |
| InChIKey | LCBIELIHMJEJOP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|