C17H29N5O2 — CID 3825464
8-(hexylamino)-3-methyl-7-(3-methylbutyl)purine-2,6-dione (PubChem CID 3825464) has the molecular formula C17H29N5O2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 8-(hexylamino)-3-methyl-7-(3-methylbutyl)purine-2,6-dione.
| Compound Name | 8-(hexylamino)-3-methyl-7-(3-methylbutyl)purine-2,6-dione |
|---|---|
| PubChem CID | 3825464 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | 8-(hexylamino)-3-methyl-7-(3-methylbutyl)purine-2,6-dione |
| SMILES | CCCCCCNc1nc2c(c(=O)[nH]c(=O)n2C)n1CCC(C)C |
| InChI | InChI=1S/C17H29N5O2/c1-5-6-7-8-10-18-16-19-14-13(22(16)11-9-12(2)3)15(23)20-17(24)21(14)4/h12H,5-11H2,1-4H3,(H,18,19)(H,20,23,24) |
| InChIKey | CNVVJVFOLCYRGW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|