C19H24ClN5O2 — CID 3389218
7-[(4-chlorophenyl)methyl]-8-(hexylamino)-3-methylpurine-2,6-dione (PubChem CID 3389218) has the molecular formula C19H24ClN5O2 and a molecular weight of 389.89 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-8-(hexylamino)-3-methylpurine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-8-(hexylamino)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 3389218 |
| Molecular Formula | C19H24ClN5O2 |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-8-(hexylamino)-3-methylpurine-2,6-dione |
| SMILES | CCCCCCNc1nc2c(c(=O)[nH]c(=O)n2C)n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H24ClN5O2/c1-3-4-5-6-11-21-18-22-16-15(17(26)23-19(27)24(16)2)25(18)12-13-7-9-14(20)10-8-13/h7-10H,3-6,11-12H2,1-2H3,(H,21,22)(H,23,26,27) |
| InChIKey | ZRZJWDGMSRURRS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|