C17H21N5O3 — CID 3157431
7-benzyl-8-(3-methoxypropylamino)-3-methylpurine-2,6-dione (PubChem CID 3157431) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 7-benzyl-8-(3-methoxypropylamino)-3-methylpurine-2,6-dione.
| Compound Name | 7-benzyl-8-(3-methoxypropylamino)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 3157431 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 7-benzyl-8-(3-methoxypropylamino)-3-methylpurine-2,6-dione |
| SMILES | COCCCNc1nc2c(c(=O)[nH]c(=O)n2C)n1Cc1ccccc1 |
| InChI | InChI=1S/C17H21N5O3/c1-21-14-13(15(23)20-17(21)24)22(11-12-7-4-3-5-8-12)16(19-14)18-9-6-10-25-2/h3-5,7-8H,6,9-11H2,1-2H3,(H,18,19)(H,20,23,24) |
| InChIKey | IPHFLWQYCUHQBY-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|