C22H19BrN6O2 — CID 22303658
7-benzyl-8-[(2E)-2-[(E)-2-bromo-3-phenylprop-2-enylidene]hydrazinyl]-3-methylpurine-2,6-dione (PubChem CID 22303658) has the molecular formula C22H19BrN6O2 and a molecular weight of 479.34 g/mol. Its IUPAC name is 7-benzyl-8-[(2E)-2-[(E)-2-bromo-3-phenylprop-2-enylidene]hydrazinyl]-3-methylpurine-2,6-dione.
| Compound Name | 7-benzyl-8-[(2E)-2-[(E)-2-bromo-3-phenylprop-2-enylidene]hydrazinyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 22303658 |
| Molecular Formula | C22H19BrN6O2 |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 7-benzyl-8-[(2E)-2-[(E)-2-bromo-3-phenylprop-2-enylidene]hydrazinyl]-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(N/N=C/C(Br)=C\c1ccccc1)n2Cc1ccccc1 |
| InChI | InChI=1S/C22H19BrN6O2/c1-28-19-18(20(30)26-22(28)31)29(14-16-10-6-3-7-11-16)21(25-19)27-24-13-17(23)12-15-8-4-2-5-9-15/h2-13H,14H2,1H3,(H,25,27)(H,26,30,31)/b17-12+,24-13+ |
| InChIKey | PKZURQVRZPRZKF-CMTUKCOLSA-N |
| XLogP | 3.31 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|