C16H27N5O3 — CID 3392963
8-(3-ethoxypropylamino)-3-methyl-7-pentylpurine-2,6-dione (PubChem CID 3392963) has the molecular formula C16H27N5O3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 8-(3-ethoxypropylamino)-3-methyl-7-pentylpurine-2,6-dione.
| Compound Name | 8-(3-ethoxypropylamino)-3-methyl-7-pentylpurine-2,6-dione |
|---|---|
| PubChem CID | 3392963 |
| Molecular Formula | C16H27N5O3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | 8-(3-ethoxypropylamino)-3-methyl-7-pentylpurine-2,6-dione |
| SMILES | CCCCCn1c(NCCCOCC)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C16H27N5O3/c1-4-6-7-10-21-12-13(20(3)16(23)19-14(12)22)18-15(21)17-9-8-11-24-5-2/h4-11H2,1-3H3,(H,17,18)(H,19,22,23) |
| InChIKey | BJQVKGKFPHENLU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|