C14H18N8O2 — CID 95313494
3,7-dimethyl-8-[[(6R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]purine-2,6-dione (PubChem CID 95313494) has the molecular formula C14H18N8O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 3,7-dimethyl-8-[[(6R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]purine-2,6-dione.
| Compound Name | 3,7-dimethyl-8-[[(6R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]purine-2,6-dione |
|---|---|
| PubChem CID | 95313494 |
| Molecular Formula | C14H18N8O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 3,7-dimethyl-8-[[(6R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]purine-2,6-dione |
| SMILES | Cc1nc2n(n1)C[C@H](Nc1nc3c(c(=O)[nH]c(=O)n3C)n1C)CC2 |
| InChI | InChI=1S/C14H18N8O2/c1-7-15-9-5-4-8(6-22(9)19-7)16-13-17-11-10(20(13)2)12(23)18-14(24)21(11)3/h8H,4-6H2,1-3H3,(H,16,17)(H,18,23,24)/t8-/m1/s1 |
| InChIKey | WZMKZVLYSVIIPR-MRVPVSSYSA-N |
| XLogP | -0.71 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |