C14H20N6O3 — CID 122566965
8-[(1-acetylpiperidin-3-yl)amino]-3,7-dimethylpurine-2,6-dione (PubChem CID 122566965) has the molecular formula C14H20N6O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is 8-[(1-acetylpiperidin-3-yl)amino]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 8-[(1-acetylpiperidin-3-yl)amino]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 122566965 |
| Molecular Formula | C14H20N6O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 8-[(1-acetylpiperidin-3-yl)amino]-3,7-dimethylpurine-2,6-dione |
| SMILES | CC(=O)N1CCCC(Nc2nc3c(c(=O)[nH]c(=O)n3C)n2C)C1 |
| InChI | InChI=1S/C14H20N6O3/c1-8(21)20-6-4-5-9(7-20)15-13-16-11-10(18(13)2)12(22)17-14(23)19(11)3/h9H,4-7H2,1-3H3,(H,15,16)(H,17,22,23) |
| InChIKey | HASSATGBHAFHGS-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |