C11H15N5O2 — CID 82466111
3,7-dimethyl-8-pyrrolidin-3-ylpurine-2,6-dione (PubChem CID 82466111) has the molecular formula C11H15N5O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is 3,7-dimethyl-8-pyrrolidin-3-ylpurine-2,6-dione.
| Compound Name | 3,7-dimethyl-8-pyrrolidin-3-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 82466111 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 3,7-dimethyl-8-pyrrolidin-3-ylpurine-2,6-dione |
| SMILES | Cn1c(C2CCNC2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C11H15N5O2/c1-15-7-9(16(2)11(18)14-10(7)17)13-8(15)6-3-4-12-5-6/h6,12H,3-5H2,1-2H3,(H,14,17,18) |
| InChIKey | GOXFJAZBDDYDTM-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |