C7H7N5O4 — CID 4655815
3,7-dimethyl-8-nitropurine-2,6-dione (PubChem CID 4655815) has the molecular formula C7H7N5O4 and a molecular weight of 225.16 g/mol. Its IUPAC name is 3,7-dimethyl-8-nitropurine-2,6-dione.
| Compound Name | 3,7-dimethyl-8-nitropurine-2,6-dione |
|---|---|
| PubChem CID | 4655815 |
| Molecular Formula | C7H7N5O4 |
| Molecular Weight | 225.16 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 3,7-dimethyl-8-nitropurine-2,6-dione |
| SMILES | Cn1c([N+](=O)[O-])nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C7H7N5O4/c1-10-3-4(8-6(10)12(15)16)11(2)7(14)9-5(3)13/h1-2H3,(H,9,13,14) |
| InChIKey | OQHHUXUHSSFYQJ-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.16 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|