C10H13N5O6 — CID 10379976
3-(2-hydroxy-3-methoxypropyl)-7-methyl-8-nitropurine-2,6-dione (PubChem CID 10379976) has the molecular formula C10H13N5O6 and a molecular weight of 299.24 g/mol. Its IUPAC name is 3-(2-hydroxy-3-methoxypropyl)-7-methyl-8-nitropurine-2,6-dione.
| Compound Name | 3-(2-hydroxy-3-methoxypropyl)-7-methyl-8-nitropurine-2,6-dione |
|---|---|
| PubChem CID | 10379976 |
| Molecular Formula | C10H13N5O6 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 3-(2-hydroxy-3-methoxypropyl)-7-methyl-8-nitropurine-2,6-dione |
| SMILES | COCC(O)Cn1c(=O)[nH]c(=O)c2c1nc([N+](=O)[O-])n2C |
| InChI | InChI=1S/C10H13N5O6/c1-13-6-7(11-9(13)15(19)20)14(3-5(16)4-21-2)10(18)12-8(6)17/h5,16H,3-4H2,1-2H3,(H,12,17,18) |
| InChIKey | SWVOBCQBTYWZPO-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 145.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|