C11H14N4O5 — CID 82464324
3-(3-methoxypropyl)-7-methyl-2,6-dioxopurine-8-carboxylic acid (PubChem CID 82464324) has the molecular formula C11H14N4O5 and a molecular weight of 282.26 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-7-methyl-2,6-dioxopurine-8-carboxylic acid.
| Compound Name | 3-(3-methoxypropyl)-7-methyl-2,6-dioxopurine-8-carboxylic acid |
|---|---|
| PubChem CID | 82464324 |
| Molecular Formula | C11H14N4O5 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-(3-methoxypropyl)-7-methyl-2,6-dioxopurine-8-carboxylic acid |
| SMILES | COCCCn1c(=O)[nH]c(=O)c2c1nc(C(=O)O)n2C |
| InChI | InChI=1S/C11H14N4O5/c1-14-6-7(12-8(14)10(17)18)15(4-3-5-20-2)11(19)13-9(6)16/h3-5H2,1-2H3,(H,17,18)(H,13,16,19) |
| InChIKey | YPLJWHCRUSEUTR-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|