C9H14N2O4 — CID 112599165
6-hydroxy-1-(3-methoxypropyl)-5-methylpyrimidine-2,4-dione (PubChem CID 112599165) has the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. Its IUPAC name is 6-hydroxy-1-(3-methoxypropyl)-5-methylpyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1-(3-methoxypropyl)-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 112599165 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 6-hydroxy-1-(3-methoxypropyl)-5-methylpyrimidine-2,4-dione |
| SMILES | COCCCn1c(O)c(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H14N2O4/c1-6-7(12)10-9(14)11(8(6)13)4-3-5-15-2/h13H,3-5H2,1-2H3,(H,10,12,14) |
| InChIKey | FAYMLSBVORWKFC-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|